Metoprolol Acid
Catalog No: FT-0672384
CAS No: 56392-14-4
- Chemical Name: Metoprolol Acid
- Molecular Formula: C14H21NO4
- Molecular Weight: 267.32
- InChI Key: PUQIRTNPJRFRCZ-UHFFFAOYSA-N
- InChI: InChI=1S/C14H21NO4/c1-10(2)15-8-12(16)9-19-13-5-3-11(4-6-13)7-14(17)18/h3-6,10,12,15-16H,7-9H2,1-2H3,(H,17,18)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 56392-14-4 |
| Flash_Point: | 242.3ºC |
| Product_Name: | atenolol acid |
| Bolling_Point: | 477.1ºC at 760mmHg |
| FW: | 267.32100 |
| Melting_Point: | 174-176ºC |
| MF: | C14H21NO4 |
| Density: | 1.159g/cm3 |
| Melting_Point: | 174-176ºC |
|---|---|
| Refractive_Index: | 1.539 |
| MF: | C14H21NO4 |
| Flash_Point: | 242.3ºC |
| LogP: | 1.44230 |
| FW: | 267.32100 |
| Density: | 1.159g/cm3 |
| PSA: | 78.79000 |
| Bolling_Point: | 477.1ºC at 760mmHg |
| Exact_Mass: | 267.14700 |
| RTECS: | CY1634360 |
|---|---|
| RIDADR: | NONH for all modes of transport |
| Symbol: | GHS07 |
| Safety_Statements: | H302 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)